About dimethyl 3-(2-methoxy-2-oxoethyl)pentanedioate;dimethyl 3-(2-methoxy-2-oxoethyl)pent-2-enedioate
dimethyl 3-(2-methoxy-2-oxoethyl)pentanedioate;dimethyl 3-(2-methoxy-2-oxoethyl)pent-2-enedioate (PubChem CID 158428615) has the molecular formula C20H30O12
and a molecular weight of 462.45 g/mol. Its IUPAC name is dimethyl 3-(2-methoxy-2-oxoethyl)pentanedioate;dimethyl 3-(2-methoxy-2-oxoethyl)pent-2-enedioate.
Molecular Properties
| Compound Name | dimethyl 3-(2-methoxy-2-oxoethyl)pentanedioate;dimethyl 3-(2-methoxy-2-oxoethyl)pent-2-enedioate |
| PubChem CID | 158428615 |
| Molecular Formula | C20H30O12 |
| Molecular Weight | 462.45 g/mol |
| Exact Mass | 462.17 |
| IUPAC Name | dimethyl 3-(2-methoxy-2-oxoethyl)pentanedioate;dimethyl 3-(2-methoxy-2-oxoethyl)pent-2-enedioate |
| SMILES | COC(=O)C=C(CC(=O)OC)CC(=O)OC.COC(=O)CC(CC(=O)OC)CC(=O)OC |
| InChI | InChI=1S/C10H16O6.C10H14O6/c2*1-14-8(11)4-7(5-9(12)15-2)6-10(13)16-3/h7H,4-6H2,1-3H3;4H,5-6H2,1-3H3 |
| InChIKey | HBJIGDWTOSSYRO-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 157.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 462.45 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze dimethyl 3-(2-methoxy-2-oxoethyl)pentanedioate;dimethyl 3-(2-methoxy-2-oxoethyl)pent-2-enedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl 3-(2-methoxy-2-oxoethyl)pentanedioate;dimethyl 3-(2-methoxy-2-oxoethyl)pent-2-enedioate?
The IUPAC name of dimethyl 3-(2-methoxy-2-oxoethyl)pentanedioate;dimethyl 3-(2-methoxy-2-oxoethyl)pent-2-enedioate (CID 158428615) is dimethyl 3-(2-methoxy-2-oxoethyl)pentanedioate;dimethyl 3-(2-methoxy-2-oxoethyl)pent-2-enedioate.
What is the SMILES notation for dimethyl 3-(2-methoxy-2-oxoethyl)pentanedioate;dimethyl 3-(2-methoxy-2-oxoethyl)pent-2-enedioate?
The canonical SMILES for dimethyl 3-(2-methoxy-2-oxoethyl)pentanedioate;dimethyl 3-(2-methoxy-2-oxoethyl)pent-2-enedioate is COC(=O)C=C(CC(=O)OC)CC(=O)OC.COC(=O)CC(CC(=O)OC)CC(=O)OC.
What is the InChIKey of dimethyl 3-(2-methoxy-2-oxoethyl)pentanedioate;dimethyl 3-(2-methoxy-2-oxoethyl)pent-2-enedioate?
The InChIKey is HBJIGDWTOSSYRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16O6.C10H14O6/c2*1-14-8(11)4-7(5-9(12)15-2)6-10(13)16-3/h7H,4-6H2,1-3H3;4H,5-6H2,1-3H3.
What are the key properties of dimethyl 3-(2-methoxy-2-oxoethyl)pentanedioate;dimethyl 3-(2-methoxy-2-oxoethyl)pent-2-enedioate?
dimethyl 3-(2-methoxy-2-oxoethyl)pentanedioate;dimethyl 3-(2-methoxy-2-oxoethyl)pent-2-enedioate has a molecular weight of 462.45 g/mol, XLogP of 0.50, 11 rotatable bonds, 0 hydrogen bond donors, and 12 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl 3-(2-methoxy-2-oxoethyl)pentanedioate;dimethyl 3-(2-methoxy-2-oxoethyl)pent-2-enedioate is sourced from PubChem (CID 158428615), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).