About 6-O-methyl 1-O-[5-(2-methylprop-2-enoyloxy)-5-oxopentanoyl] 2-methyl-5-methylidenehex-2-enedioate
6-O-methyl 1-O-[5-(2-methylprop-2-enoyloxy)-5-oxopentanoyl] 2-methyl-5-methylidenehex-2-enedioate (PubChem CID 90924447) has the molecular formula C18H22O8
and a molecular weight of 366.37 g/mol. Its IUPAC name is 6-O-methyl 1-O-[5-(2-methylprop-2-enoyloxy)-5-oxopentanoyl] 2-methyl-5-methylidenehex-2-enedioate.
Molecular Properties
| Compound Name | 6-O-methyl 1-O-[5-(2-methylprop-2-enoyloxy)-5-oxopentanoyl] 2-methyl-5-methylidenehex-2-enedioate |
| PubChem CID | 90924447 |
| Molecular Formula | C18H22O8 |
| Molecular Weight | 366.37 g/mol |
| Exact Mass | 366.13 |
| IUPAC Name | 6-O-methyl 1-O-[5-(2-methylprop-2-enoyloxy)-5-oxopentanoyl] 2-methyl-5-methylidenehex-2-enedioate |
| SMILES | C=C(C)C(=O)OC(=O)CCCC(=O)OC(=O)C(C)=CCC(=C)C(=O)OC |
| InChI | InChI=1S/C18H22O8/c1-11(2)16(21)25-14(19)7-6-8-15(20)26-18(23)13(4)10-9-12(3)17(22)24-5/h10H,1,3,6-9H2,2,4-5H3 |
| InChIKey | HVGQIQURMRZYNQ-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 113.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.37 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 6-O-methyl 1-O-[5-(2-methylprop-2-enoyloxy)-5-oxopentanoyl] 2-methyl-5-methylidenehex-2-enedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-O-methyl 1-O-[5-(2-methylprop-2-enoyloxy)-5-oxopentanoyl] 2-methyl-5-methylidenehex-2-enedioate?
The IUPAC name of 6-O-methyl 1-O-[5-(2-methylprop-2-enoyloxy)-5-oxopentanoyl] 2-methyl-5-methylidenehex-2-enedioate (CID 90924447) is 6-O-methyl 1-O-[5-(2-methylprop-2-enoyloxy)-5-oxopentanoyl] 2-methyl-5-methylidenehex-2-enedioate.
What is the SMILES notation for 6-O-methyl 1-O-[5-(2-methylprop-2-enoyloxy)-5-oxopentanoyl] 2-methyl-5-methylidenehex-2-enedioate?
The canonical SMILES for 6-O-methyl 1-O-[5-(2-methylprop-2-enoyloxy)-5-oxopentanoyl] 2-methyl-5-methylidenehex-2-enedioate is C=C(C)C(=O)OC(=O)CCCC(=O)OC(=O)C(C)=CCC(=C)C(=O)OC.
What is the InChIKey of 6-O-methyl 1-O-[5-(2-methylprop-2-enoyloxy)-5-oxopentanoyl] 2-methyl-5-methylidenehex-2-enedioate?
The InChIKey is HVGQIQURMRZYNQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22O8/c1-11(2)16(21)25-14(19)7-6-8-15(20)26-18(23)13(4)10-9-12(3)17(22)24-5/h10H,1,3,6-9H2,2,4-5H3.
What are the key properties of 6-O-methyl 1-O-[5-(2-methylprop-2-enoyloxy)-5-oxopentanoyl] 2-methyl-5-methylidenehex-2-enedioate?
6-O-methyl 1-O-[5-(2-methylprop-2-enoyloxy)-5-oxopentanoyl] 2-methyl-5-methylidenehex-2-enedioate has a molecular weight of 366.37 g/mol, XLogP of 1.94, 9 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 6-O-methyl 1-O-[5-(2-methylprop-2-enoyloxy)-5-oxopentanoyl] 2-methyl-5-methylidenehex-2-enedioate is sourced from PubChem (CID 90924447), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).