C25H40O4 — CID 91694958
bis[(2Z)-3,7-dimethylocta-2,6-dienyl] pentanedioate (PubChem CID 91694958) has the molecular formula C25H40O4 and a molecular weight of 404.59 g/mol. Its IUPAC name is bis[(2Z)-3,7-dimethylocta-2,6-dienyl] pentanedioate.
| Compound Name | bis[(2Z)-3,7-dimethylocta-2,6-dienyl] pentanedioate |
|---|---|
| PubChem CID | 91694958 |
| Molecular Formula | C25H40O4 |
| Molecular Weight | 404.59 g/mol |
| Exact Mass | 404.29 |
| IUPAC Name | bis[(2Z)-3,7-dimethylocta-2,6-dienyl] pentanedioate |
| SMILES | CC(C)=CCC/C(C)=C\COC(=O)CCCC(=O)OC/C=C(/C)CCC=C(C)C |
| InChI | InChI=1S/C25H40O4/c1-20(2)10-7-12-22(5)16-18-28-24(26)14-9-15-25(27)29-19-17-23(6)13-8-11-21(3)4/h10-11,16-17H,7-9,12-15,18-19H2,1-6H3/b22-16-,23-17- |
| InChIKey | GRFMDIUFZRJCIH-IDUDEYGOSA-N |
| XLogP | 6.63 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.59 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|