C9H13Cl3O4 — CID 23272839
methyl 3-chloro-2-(2,3-dichloro-2-methylpropanoyl)oxy-2-methylpropanoate (PubChem CID 23272839) has the molecular formula C9H13Cl3O4 and a molecular weight of 291.56 g/mol. Its IUPAC name is methyl 3-chloro-2-(2,3-dichloro-2-methylpropanoyl)oxy-2-methylpropanoate.
| Compound Name | methyl 3-chloro-2-(2,3-dichloro-2-methylpropanoyl)oxy-2-methylpropanoate |
|---|---|
| PubChem CID | 23272839 |
| Molecular Formula | C9H13Cl3O4 |
| Molecular Weight | 291.56 g/mol |
| Exact Mass | 289.99 |
| IUPAC Name | methyl 3-chloro-2-(2,3-dichloro-2-methylpropanoyl)oxy-2-methylpropanoate |
| SMILES | COC(=O)C(C)(CCl)OC(=O)C(C)(Cl)CCl |
| InChI | InChI=1S/C9H13Cl3O4/c1-8(12,4-10)6(13)16-9(2,5-11)7(14)15-3/h4-5H2,1-3H3 |
| InChIKey | JYUKCYILYFADEL-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.56 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|