About diethyl [(E)-1-phenylprop-1-enyl] phosphite
diethyl [(E)-1-phenylprop-1-enyl] phosphite (PubChem CID 23273338) has the molecular formula C13H19O3P
and a molecular weight of 254.27 g/mol. Its IUPAC name is diethyl [(E)-1-phenylprop-1-enyl] phosphite.
Molecular Properties
| Compound Name | diethyl [(E)-1-phenylprop-1-enyl] phosphite |
| PubChem CID | 23273338 |
| Molecular Formula | C13H19O3P |
| Molecular Weight | 254.27 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | diethyl [(E)-1-phenylprop-1-enyl] phosphite |
| SMILES | C/C=C(/OP(OCC)OCC)c1ccccc1 |
| InChI | InChI=1S/C13H19O3P/c1-4-13(12-10-8-7-9-11-12)16-17(14-5-2)15-6-3/h4,7-11H,5-6H2,1-3H3/b13-4+ |
| InChIKey | QOANZURHLYKHDT-YIXHJXPBSA-N |
| XLogP | 4.36 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.27 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze diethyl [(E)-1-phenylprop-1-enyl] phosphite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl [(E)-1-phenylprop-1-enyl] phosphite?
The IUPAC name of diethyl [(E)-1-phenylprop-1-enyl] phosphite (CID 23273338) is diethyl [(E)-1-phenylprop-1-enyl] phosphite.
What is the SMILES notation for diethyl [(E)-1-phenylprop-1-enyl] phosphite?
The canonical SMILES for diethyl [(E)-1-phenylprop-1-enyl] phosphite is C/C=C(/OP(OCC)OCC)c1ccccc1.
What is the InChIKey of diethyl [(E)-1-phenylprop-1-enyl] phosphite?
The InChIKey is QOANZURHLYKHDT-YIXHJXPBSA-N. The full InChI is InChI=1S/C13H19O3P/c1-4-13(12-10-8-7-9-11-12)16-17(14-5-2)15-6-3/h4,7-11H,5-6H2,1-3H3/b13-4+.
What are the key properties of diethyl [(E)-1-phenylprop-1-enyl] phosphite?
diethyl [(E)-1-phenylprop-1-enyl] phosphite has a molecular weight of 254.27 g/mol, XLogP of 4.36, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl [(E)-1-phenylprop-1-enyl] phosphite is sourced from PubChem (CID 23273338), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).