About 1,8-diazatricyclo[7.6.0.03,7]pentadeca-3(7),8-dien-2-one
1,8-diazatricyclo[7.6.0.03,7]pentadeca-3(7),8-dien-2-one (PubChem CID 23274244) has the molecular formula C13H18N2O
and a molecular weight of 218.30 g/mol. Its IUPAC name is 1,8-diazatricyclo[7.6.0.03,7]pentadeca-3(7),8-dien-2-one.
Analyze 1,8-diazatricyclo[7.6.0.03,7]pentadeca-3(7),8-dien-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,8-diazatricyclo[7.6.0.03,7]pentadeca-3(7),8-dien-2-one?
The IUPAC name of 1,8-diazatricyclo[7.6.0.03,7]pentadeca-3(7),8-dien-2-one (CID 23274244) is 1,8-diazatricyclo[7.6.0.03,7]pentadeca-3(7),8-dien-2-one.
What is the SMILES notation for 1,8-diazatricyclo[7.6.0.03,7]pentadeca-3(7),8-dien-2-one?
The canonical SMILES for 1,8-diazatricyclo[7.6.0.03,7]pentadeca-3(7),8-dien-2-one is O=c1c2c(nc3n1CCCCCC3)CCC2.
What is the InChIKey of 1,8-diazatricyclo[7.6.0.03,7]pentadeca-3(7),8-dien-2-one?
The InChIKey is IFHZRKSBMOVGFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N2O/c16-13-10-6-5-7-11(10)14-12-8-3-1-2-4-9-15(12)13/h1-9H2.
What are the key properties of 1,8-diazatricyclo[7.6.0.03,7]pentadeca-3(7),8-dien-2-one?
1,8-diazatricyclo[7.6.0.03,7]pentadeca-3(7),8-dien-2-one has a molecular weight of 218.30 g/mol, XLogP of 1.85, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,8-diazatricyclo[7.6.0.03,7]pentadeca-3(7),8-dien-2-one is sourced from PubChem (CID 23274244), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).