C11H15FNO5P — CID 23275552
2-[[dimethoxyphosphoryl-(2-fluorophenyl)methyl]amino]acetic acid (PubChem CID 23275552) has the molecular formula C11H15FNO5P and a molecular weight of 291.22 g/mol. Its IUPAC name is 2-[[dimethoxyphosphoryl-(2-fluorophenyl)methyl]amino]acetic acid.
| Compound Name | 2-[[dimethoxyphosphoryl-(2-fluorophenyl)methyl]amino]acetic acid |
|---|---|
| PubChem CID | 23275552 |
| Molecular Formula | C11H15FNO5P |
| Molecular Weight | 291.22 g/mol |
| Exact Mass | 291.07 |
| IUPAC Name | 2-[[dimethoxyphosphoryl-(2-fluorophenyl)methyl]amino]acetic acid |
| SMILES | COP(=O)(OC)C(NCC(=O)O)c1ccccc1F |
| InChI | InChI=1S/C11H15FNO5P/c1-17-19(16,18-2)11(13-7-10(14)15)8-5-3-4-6-9(8)12/h3-6,11,13H,7H2,1-2H3,(H,14,15) |
| InChIKey | BHXXALLSNQEZCY-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.22 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|