C13H16FN2O4P — CID 11551400
N-[dimethoxyphosphoryl-(2-fluorophenyl)methyl]-5-methyl-1,2-oxazol-3-amine (PubChem CID 11551400) has the molecular formula C13H16FN2O4P and a molecular weight of 314.25 g/mol. Its IUPAC name is N-[dimethoxyphosphoryl-(2-fluorophenyl)methyl]-5-methyl-1,2-oxazol-3-amine.
| Compound Name | N-[dimethoxyphosphoryl-(2-fluorophenyl)methyl]-5-methyl-1,2-oxazol-3-amine |
|---|---|
| PubChem CID | 11551400 |
| Molecular Formula | C13H16FN2O4P |
| Molecular Weight | 314.25 g/mol |
| Exact Mass | 314.08 |
| IUPAC Name | N-[dimethoxyphosphoryl-(2-fluorophenyl)methyl]-5-methyl-1,2-oxazol-3-amine |
| SMILES | COP(=O)(OC)C(Nc1cc(C)on1)c1ccccc1F |
| InChI | InChI=1S/C13H16FN2O4P/c1-9-8-12(16-20-9)15-13(21(17,18-2)19-3)10-6-4-5-7-11(10)14/h4-8,13H,1-3H3,(H,15,16) |
| InChIKey | BMQYEJJICJYACK-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 73.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.25 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|