C5H11N2+ — CID 23279195
1,2-dimethyl-3,4-dihydropyrazol-1-ium (PubChem CID 23279195) has the molecular formula C5H11N2+ and a molecular weight of 99.16 g/mol. Its IUPAC name is 1,2-dimethyl-3,4-dihydropyrazol-1-ium.
| Compound Name | 1,2-dimethyl-3,4-dihydropyrazol-1-ium |
|---|---|
| PubChem CID | 23279195 |
| Molecular Formula | C5H11N2+ |
| Molecular Weight | 99.16 g/mol |
| Exact Mass | 99.09 |
| IUPAC Name | 1,2-dimethyl-3,4-dihydropyrazol-1-ium |
| SMILES | CN1CCC=[N+]1C |
| InChI | InChI=1S/C5H11N2/c1-6-4-3-5-7(6)2/h4H,3,5H2,1-2H3/q+1 |
| InChIKey | NKHXSAMAVTTYAB-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 99.16 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|