About 5-methoxy-9-methylidene-7-propan-2-yl-1,4,6-trioxa-5λ5-phosphaspiro[4.4]non-7-ene
5-methoxy-9-methylidene-7-propan-2-yl-1,4,6-trioxa-5λ5-phosphaspiro[4.4]non-7-ene (PubChem CID 23280171) has the molecular formula C10H17O4P
and a molecular weight of 232.22 g/mol. Its IUPAC name is 5-methoxy-9-methylidene-7-propan-2-yl-1,4,6-trioxa-5λ5-phosphaspiro[4.4]non-7-ene.
Molecular Properties
| Compound Name | 5-methoxy-9-methylidene-7-propan-2-yl-1,4,6-trioxa-5λ5-phosphaspiro[4.4]non-7-ene |
| PubChem CID | 23280171 |
| Molecular Formula | C10H17O4P |
| Molecular Weight | 232.22 g/mol |
| Exact Mass | 232.09 |
| IUPAC Name | 5-methoxy-9-methylidene-7-propan-2-yl-1,4,6-trioxa-5λ5-phosphaspiro[4.4]non-7-ene |
| SMILES | C=C1C=C(C(C)C)OP12(OC)OCCO2 |
| InChI | InChI=1S/C10H17O4P/c1-8(2)10-7-9(3)15(11-4,14-10)12-5-6-13-15/h7-8H,3,5-6H2,1-2,4H3 |
| InChIKey | BNPLSYODKUFDRX-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.22 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 5-methoxy-9-methylidene-7-propan-2-yl-1,4,6-trioxa-5λ5-phosphaspiro[4.4]non-7-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methoxy-9-methylidene-7-propan-2-yl-1,4,6-trioxa-5λ5-phosphaspiro[4.4]non-7-ene?
The IUPAC name of 5-methoxy-9-methylidene-7-propan-2-yl-1,4,6-trioxa-5λ5-phosphaspiro[4.4]non-7-ene (CID 23280171) is 5-methoxy-9-methylidene-7-propan-2-yl-1,4,6-trioxa-5λ5-phosphaspiro[4.4]non-7-ene.
What is the SMILES notation for 5-methoxy-9-methylidene-7-propan-2-yl-1,4,6-trioxa-5λ5-phosphaspiro[4.4]non-7-ene?
The canonical SMILES for 5-methoxy-9-methylidene-7-propan-2-yl-1,4,6-trioxa-5λ5-phosphaspiro[4.4]non-7-ene is C=C1C=C(C(C)C)OP12(OC)OCCO2.
What is the InChIKey of 5-methoxy-9-methylidene-7-propan-2-yl-1,4,6-trioxa-5λ5-phosphaspiro[4.4]non-7-ene?
The InChIKey is BNPLSYODKUFDRX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17O4P/c1-8(2)10-7-9(3)15(11-4,14-10)12-5-6-13-15/h7-8H,3,5-6H2,1-2,4H3.
What are the key properties of 5-methoxy-9-methylidene-7-propan-2-yl-1,4,6-trioxa-5λ5-phosphaspiro[4.4]non-7-ene?
5-methoxy-9-methylidene-7-propan-2-yl-1,4,6-trioxa-5λ5-phosphaspiro[4.4]non-7-ene has a molecular weight of 232.22 g/mol, XLogP of 2.98, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methoxy-9-methylidene-7-propan-2-yl-1,4,6-trioxa-5λ5-phosphaspiro[4.4]non-7-ene is sourced from PubChem (CID 23280171), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).