C10H19O4P — CID 23418981
2,2,2-trimethoxy-3-methylidene-5-propan-2-yl-1,2λ5-oxaphosphole (PubChem CID 23418981) has the molecular formula C10H19O4P and a molecular weight of 234.23 g/mol. Its IUPAC name is 2,2,2-trimethoxy-3-methylidene-5-propan-2-yl-1,2λ5-oxaphosphole.
| Compound Name | 2,2,2-trimethoxy-3-methylidene-5-propan-2-yl-1,2λ5-oxaphosphole |
|---|---|
| PubChem CID | 23418981 |
| Molecular Formula | C10H19O4P |
| Molecular Weight | 234.23 g/mol |
| Exact Mass | 234.10 |
| IUPAC Name | 2,2,2-trimethoxy-3-methylidene-5-propan-2-yl-1,2λ5-oxaphosphole |
| SMILES | C=C1C=C(C(C)C)OP1(OC)(OC)OC |
| InChI | InChI=1S/C10H19O4P/c1-8(2)10-7-9(3)15(11-4,12-5,13-6)14-10/h7-8H,3H2,1-2,4-6H3 |
| InChIKey | PKQZNLDDWJLSDT-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.23 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|