C29H43N3O4S — CID 23285266
methyl 1-[4-[benzenesulfonyl(methyl)amino]-3-phenylbutyl]-2-(pentylamino)piperidine-4-carboxylate (PubChem CID 23285266) has the molecular formula C29H43N3O4S and a molecular weight of 529.75 g/mol. Its IUPAC name is methyl 1-[4-[benzenesulfonyl(methyl)amino]-3-phenylbutyl]-2-(pentylamino)piperidine-4-carboxylate.
| Compound Name | methyl 1-[4-[benzenesulfonyl(methyl)amino]-3-phenylbutyl]-2-(pentylamino)piperidine-4-carboxylate |
|---|---|
| PubChem CID | 23285266 |
| Molecular Formula | C29H43N3O4S |
| Molecular Weight | 529.75 g/mol |
| Exact Mass | 529.30 |
| IUPAC Name | methyl 1-[4-[benzenesulfonyl(methyl)amino]-3-phenylbutyl]-2-(pentylamino)piperidine-4-carboxylate |
| SMILES | CCCCCNC1CC(C(=O)OC)CCN1CCC(CN(C)S(=O)(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H43N3O4S/c1-4-5-12-19-30-28-22-25(29(33)36-3)17-20-32(28)21-18-26(24-13-8-6-9-14-24)23-31(2)37(34,35)27-15-10-7-11-16-27/h6-11,13-16,25-26,28,30H,4-5,12,17-23H2,1-3H3 |
| InChIKey | VOKUKAFNRLAOCA-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.75 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|