C35H48ClN3O4S — CID 70259501
benzyl (2R,4S)-1-[4-[benzenesulfonyl(methyl)amino]-3-phenylbutyl]-2-(pentylamino)piperidine-4-carboxylate;hydrochloride (PubChem CID 70259501) has the molecular formula C35H48ClN3O4S and a molecular weight of 642.31 g/mol. Its IUPAC name is benzyl (2R,4S)-1-[4-[benzenesulfonyl(methyl)amino]-3-phenylbutyl]-2-(pentylamino)piperidine-4-carboxylate;hydrochloride.
| Compound Name | benzyl (2R,4S)-1-[4-[benzenesulfonyl(methyl)amino]-3-phenylbutyl]-2-(pentylamino)piperidine-4-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 70259501 |
| Molecular Formula | C35H48ClN3O4S |
| Molecular Weight | 642.31 g/mol |
| Exact Mass | 641.31 |
| IUPAC Name | benzyl (2R,4S)-1-[4-[benzenesulfonyl(methyl)amino]-3-phenylbutyl]-2-(pentylamino)piperidine-4-carboxylate;hydrochloride |
| SMILES | CCCCCN[C@H]1C[C@@H](C(=O)OCc2ccccc2)CCN1CCC(CN(C)S(=O)(=O)c1ccccc1)c1ccccc1.Cl |
| InChI | InChI=1S/C35H47N3O4S.ClH/c1-3-4-14-23-36-34-26-31(35(39)42-28-29-15-8-5-9-16-29)21-24-38(34)25-22-32(30-17-10-6-11-18-30)27-37(2)43(40,41)33-19-12-7-13-20-33;/h5-13,15-20,31-32,34,36H,3-4,14,21-28H2,1-2H3;1H/t31-,32?,34+;/m0./s1 |
| InChIKey | AEQUKEKGEUCHJE-DWAUPZKYSA-N |
| XLogP | 6.46 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.31 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|