C7H15ClF3NO — CID 23290106
3-amino-1,1,1-trifluoro-5-methylhexan-2-ol;hydrochloride (PubChem CID 23290106) has the molecular formula C7H15ClF3NO and a molecular weight of 221.65 g/mol. Its IUPAC name is 3-amino-1,1,1-trifluoro-5-methylhexan-2-ol;hydrochloride.
| Compound Name | 3-amino-1,1,1-trifluoro-5-methylhexan-2-ol;hydrochloride |
|---|---|
| PubChem CID | 23290106 |
| Molecular Formula | C7H15ClF3NO |
| Molecular Weight | 221.65 g/mol |
| Exact Mass | 221.08 |
| IUPAC Name | 3-amino-1,1,1-trifluoro-5-methylhexan-2-ol;hydrochloride |
| SMILES | CC(C)CC(N)C(O)C(F)(F)F.Cl |
| InChI | InChI=1S/C7H14F3NO.ClH/c1-4(2)3-5(11)6(12)7(8,9)10;/h4-6,12H,3,11H2,1-2H3;1H |
| InChIKey | SGCMXGJLZCBBDU-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.65 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |