C17H25N3O6 — CID 23290647
(2,5-dioxopyrrolidin-1-yl) 4-[6-(prop-2-enoylamino)hexanoylamino]butanoate (PubChem CID 23290647) has the molecular formula C17H25N3O6 and a molecular weight of 367.40 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 4-[6-(prop-2-enoylamino)hexanoylamino]butanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 4-[6-(prop-2-enoylamino)hexanoylamino]butanoate |
|---|---|
| PubChem CID | 23290647 |
| Molecular Formula | C17H25N3O6 |
| Molecular Weight | 367.40 g/mol |
| Exact Mass | 367.17 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 4-[6-(prop-2-enoylamino)hexanoylamino]butanoate |
| SMILES | C=CC(=O)NCCCCCC(=O)NCCCC(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C17H25N3O6/c1-2-13(21)18-11-5-3-4-7-14(22)19-12-6-8-17(25)26-20-15(23)9-10-16(20)24/h2H,1,3-12H2,(H,18,21)(H,19,22) |
| InChIKey | IIDVGMVIBALNIZ-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.40 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|