About 5-bromo-4-hydroxy-2-methoxybenzaldehyde;cyclohexanamine
5-bromo-4-hydroxy-2-methoxybenzaldehyde;cyclohexanamine (PubChem CID 23291649) has the molecular formula C14H20BrNO3
and a molecular weight of 330.22 g/mol. Its IUPAC name is 5-bromo-4-hydroxy-2-methoxybenzaldehyde;cyclohexanamine.
Molecular Properties
| Compound Name | 5-bromo-4-hydroxy-2-methoxybenzaldehyde;cyclohexanamine |
| PubChem CID | 23291649 |
| Molecular Formula | C14H20BrNO3 |
| Molecular Weight | 330.22 g/mol |
| Exact Mass | 329.06 |
| IUPAC Name | 5-bromo-4-hydroxy-2-methoxybenzaldehyde;cyclohexanamine |
| SMILES | COc1cc(O)c(Br)cc1C=O.NC1CCCCC1 |
| InChI | InChI=1S/C8H7BrO3.C6H13N/c1-12-8-3-7(11)6(9)2-5(8)4-10;7-6-4-2-1-3-5-6/h2-4,11H,1H3;6H,1-5,7H2 |
| InChIKey | REGJHQISIFJQIJ-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.22 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 5-bromo-4-hydroxy-2-methoxybenzaldehyde;cyclohexanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-4-hydroxy-2-methoxybenzaldehyde;cyclohexanamine?
The IUPAC name of 5-bromo-4-hydroxy-2-methoxybenzaldehyde;cyclohexanamine (CID 23291649) is 5-bromo-4-hydroxy-2-methoxybenzaldehyde;cyclohexanamine.
What is the SMILES notation for 5-bromo-4-hydroxy-2-methoxybenzaldehyde;cyclohexanamine?
The canonical SMILES for 5-bromo-4-hydroxy-2-methoxybenzaldehyde;cyclohexanamine is COc1cc(O)c(Br)cc1C=O.NC1CCCCC1.
What is the InChIKey of 5-bromo-4-hydroxy-2-methoxybenzaldehyde;cyclohexanamine?
The InChIKey is REGJHQISIFJQIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7BrO3.C6H13N/c1-12-8-3-7(11)6(9)2-5(8)4-10;7-6-4-2-1-3-5-6/h2-4,11H,1H3;6H,1-5,7H2.
What are the key properties of 5-bromo-4-hydroxy-2-methoxybenzaldehyde;cyclohexanamine?
5-bromo-4-hydroxy-2-methoxybenzaldehyde;cyclohexanamine has a molecular weight of 330.22 g/mol, XLogP of 3.25, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-4-hydroxy-2-methoxybenzaldehyde;cyclohexanamine is sourced from PubChem (CID 23291649), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).