C29H26N4O4S — CID 2329401
4-[(4E)-4-[(1,3-diphenylpyrazol-4-yl)methylidene]-5-oxo-1,3-oxazol-2-yl]-N,N-diethylbenzenesulfonamide (PubChem CID 2329401) has the molecular formula C29H26N4O4S and a molecular weight of 526.62 g/mol. Its IUPAC name is 4-[(4E)-4-[(1,3-diphenylpyrazol-4-yl)methylidene]-5-oxo-1,3-oxazol-2-yl]-N,N-diethylbenzenesulfonamide.
| Compound Name | 4-[(4E)-4-[(1,3-diphenylpyrazol-4-yl)methylidene]-5-oxo-1,3-oxazol-2-yl]-N,N-diethylbenzenesulfonamide |
|---|---|
| PubChem CID | 2329401 |
| Molecular Formula | C29H26N4O4S |
| Molecular Weight | 526.62 g/mol |
| Exact Mass | 526.17 |
| IUPAC Name | 4-[(4E)-4-[(1,3-diphenylpyrazol-4-yl)methylidene]-5-oxo-1,3-oxazol-2-yl]-N,N-diethylbenzenesulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(C2=N/C(=C/c3cn(-c4ccccc4)nc3-c3ccccc3)C(=O)O2)cc1 |
| InChI | InChI=1S/C29H26N4O4S/c1-3-32(4-2)38(35,36)25-17-15-22(16-18-25)28-30-26(29(34)37-28)19-23-20-33(24-13-9-6-10-14-24)31-27(23)21-11-7-5-8-12-21/h5-20H,3-4H2,1-2H3/b26-19+ |
| InChIKey | PDVTVZGYOYPICL-LGUFXXKBSA-N |
| XLogP | 4.91 |
| TPSA | 93.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.62 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|