C20H25Cl2NO2 — CID 23294474
4-[2-[4-[chloro(phenyl)methyl]piperidin-1-yl]ethoxy]phenol;hydrochloride (PubChem CID 23294474) has the molecular formula C20H25Cl2NO2 and a molecular weight of 382.33 g/mol. Its IUPAC name is 4-[2-[4-[chloro(phenyl)methyl]piperidin-1-yl]ethoxy]phenol;hydrochloride.
| Compound Name | 4-[2-[4-[chloro(phenyl)methyl]piperidin-1-yl]ethoxy]phenol;hydrochloride |
|---|---|
| PubChem CID | 23294474 |
| Molecular Formula | C20H25Cl2NO2 |
| Molecular Weight | 382.33 g/mol |
| Exact Mass | 381.13 |
| IUPAC Name | 4-[2-[4-[chloro(phenyl)methyl]piperidin-1-yl]ethoxy]phenol;hydrochloride |
| SMILES | Cl.Oc1ccc(OCCN2CCC(C(Cl)c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C20H24ClNO2.ClH/c21-20(16-4-2-1-3-5-16)17-10-12-22(13-11-17)14-15-24-19-8-6-18(23)7-9-19;/h1-9,17,20,23H,10-15H2;1H |
| InChIKey | DIBVBBJMKVPDOH-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.33 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|