C22H29ClN2O — CID 57145177
N-[(4-chlorophenyl)-[1-(2-phenoxyethyl)piperidin-4-yl]methyl]ethanamine (PubChem CID 57145177) has the molecular formula C22H29ClN2O and a molecular weight of 372.94 g/mol. Its IUPAC name is N-[(4-chlorophenyl)-[1-(2-phenoxyethyl)piperidin-4-yl]methyl]ethanamine.
| Compound Name | N-[(4-chlorophenyl)-[1-(2-phenoxyethyl)piperidin-4-yl]methyl]ethanamine |
|---|---|
| PubChem CID | 57145177 |
| Molecular Formula | C22H29ClN2O |
| Molecular Weight | 372.94 g/mol |
| Exact Mass | 372.20 |
| IUPAC Name | N-[(4-chlorophenyl)-[1-(2-phenoxyethyl)piperidin-4-yl]methyl]ethanamine |
| SMILES | CCNC(c1ccc(Cl)cc1)C1CCN(CCOc2ccccc2)CC1 |
| InChI | InChI=1S/C22H29ClN2O/c1-2-24-22(18-8-10-20(23)11-9-18)19-12-14-25(15-13-19)16-17-26-21-6-4-3-5-7-21/h3-11,19,22,24H,2,12-17H2,1H3 |
| InChIKey | JDLNMCIZLZBIQY-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.94 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |