C22H27FN2 — CID 23295231
2-ethyl-4-(5-fluoro-2,4-dimethylphenyl)-1-pentylbenzimidazole (PubChem CID 23295231) has the molecular formula C22H27FN2 and a molecular weight of 338.47 g/mol. Its IUPAC name is 2-ethyl-4-(5-fluoro-2,4-dimethylphenyl)-1-pentylbenzimidazole.
| Compound Name | 2-ethyl-4-(5-fluoro-2,4-dimethylphenyl)-1-pentylbenzimidazole |
|---|---|
| PubChem CID | 23295231 |
| Molecular Formula | C22H27FN2 |
| Molecular Weight | 338.47 g/mol |
| Exact Mass | 338.22 |
| IUPAC Name | 2-ethyl-4-(5-fluoro-2,4-dimethylphenyl)-1-pentylbenzimidazole |
| SMILES | CCCCCn1c(CC)nc2c(-c3cc(F)c(C)cc3C)cccc21 |
| InChI | InChI=1S/C22H27FN2/c1-5-7-8-12-25-20-11-9-10-17(22(20)24-21(25)6-2)18-14-19(23)16(4)13-15(18)3/h9-11,13-14H,5-8,12H2,1-4H3 |
| InChIKey | GBGWGBRUFRHVKV-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.47 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|