C12H24O2S — CID 23295901
2,6-dimethyl-9-methylsulfonylnon-2-ene (PubChem CID 23295901) has the molecular formula C12H24O2S and a molecular weight of 232.39 g/mol. Its IUPAC name is 2,6-dimethyl-9-methylsulfonylnon-2-ene.
| Compound Name | 2,6-dimethyl-9-methylsulfonylnon-2-ene |
|---|---|
| PubChem CID | 23295901 |
| Molecular Formula | C12H24O2S |
| Molecular Weight | 232.39 g/mol |
| Exact Mass | 232.15 |
| IUPAC Name | 2,6-dimethyl-9-methylsulfonylnon-2-ene |
| SMILES | CC(C)=CCCC(C)CCCS(C)(=O)=O |
| InChI | InChI=1S/C12H24O2S/c1-11(2)7-5-8-12(3)9-6-10-15(4,13)14/h7,12H,5-6,8-10H2,1-4H3 |
| InChIKey | POFLOKMLBURRLA-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.39 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|