C10H17NaO3S — CID 23709790
sodium (4-propan-2-ylcyclohexen-1-yl)methanesulfonate (PubChem CID 23709790) has the molecular formula C10H17NaO3S and a molecular weight of 240.30 g/mol. Its IUPAC name is sodium (4-propan-2-ylcyclohexen-1-yl)methanesulfonate.
| Compound Name | sodium (4-propan-2-ylcyclohexen-1-yl)methanesulfonate |
|---|---|
| PubChem CID | 23709790 |
| Molecular Formula | C10H17NaO3S |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.08 |
| IUPAC Name | sodium (4-propan-2-ylcyclohexen-1-yl)methanesulfonate |
| SMILES | CC(C)C1CC=C(CS(=O)(=O)[O-])CC1.[Na+] |
| InChI | InChI=1S/C10H18O3S.Na/c1-8(2)10-5-3-9(4-6-10)7-14(11,12)13;/h3,8,10H,4-7H2,1-2H3,(H,11,12,13);/q;+1/p-1 |
| InChIKey | PRBAQKOGDVWIMX-UHFFFAOYSA-M |
| XLogP | -1.08 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|