C15H12F2N2 — CID 23297042
2-(3,4-difluorophenyl)-5-pent-1-ynylpyrimidine (PubChem CID 23297042) has the molecular formula C15H12F2N2 and a molecular weight of 258.27 g/mol. Its IUPAC name is 2-(3,4-difluorophenyl)-5-pent-1-ynylpyrimidine.
| Compound Name | 2-(3,4-difluorophenyl)-5-pent-1-ynylpyrimidine |
|---|---|
| PubChem CID | 23297042 |
| Molecular Formula | C15H12F2N2 |
| Molecular Weight | 258.27 g/mol |
| Exact Mass | 258.10 |
| IUPAC Name | 2-(3,4-difluorophenyl)-5-pent-1-ynylpyrimidine |
| SMILES | CCCC#Cc1cnc(-c2ccc(F)c(F)c2)nc1 |
| InChI | InChI=1S/C15H12F2N2/c1-2-3-4-5-11-9-18-15(19-10-11)12-6-7-13(16)14(17)8-12/h6-10H,2-3H2,1H3 |
| InChIKey | IUUQFSLPIFBTKF-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.27 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|