C11H12O3S — CID 23301505
methyl 2-formyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 23301505) has the molecular formula C11H12O3S and a molecular weight of 224.28 g/mol. Its IUPAC name is methyl 2-formyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | methyl 2-formyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 23301505 |
| Molecular Formula | C11H12O3S |
| Molecular Weight | 224.28 g/mol |
| Exact Mass | 224.05 |
| IUPAC Name | methyl 2-formyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | COC(=O)c1c(C=O)sc2c1CCCC2 |
| InChI | InChI=1S/C11H12O3S/c1-14-11(13)10-7-4-2-3-5-8(7)15-9(10)6-12/h6H,2-5H2,1H3 |
| InChIKey | PUPFYYBVGMMUAN-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.28 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|