C19H19N5S — CID 23303057
1-[(4-phenylpiperazin-1-yl)methyl]-[1,2,4]thiadiazolo[4,5-a]benzimidazole (PubChem CID 23303057) has the molecular formula C19H19N5S and a molecular weight of 349.46 g/mol. Its IUPAC name is 1-[(4-phenylpiperazin-1-yl)methyl]-[1,2,4]thiadiazolo[4,5-a]benzimidazole.
| Compound Name | 1-[(4-phenylpiperazin-1-yl)methyl]-[1,2,4]thiadiazolo[4,5-a]benzimidazole |
|---|---|
| PubChem CID | 23303057 |
| Molecular Formula | C19H19N5S |
| Molecular Weight | 349.46 g/mol |
| Exact Mass | 349.14 |
| IUPAC Name | 1-[(4-phenylpiperazin-1-yl)methyl]-[1,2,4]thiadiazolo[4,5-a]benzimidazole |
| SMILES | c1ccc(N2CCN(Cc3nsc4nc5ccccc5n34)CC2)cc1 |
| InChI | InChI=1S/C19H19N5S/c1-2-6-15(7-3-1)23-12-10-22(11-13-23)14-18-21-25-19-20-16-8-4-5-9-17(16)24(18)19/h1-9H,10-14H2 |
| InChIKey | KFCLDTQOCKUYDF-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 36.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.46 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het_thio_N_5A(3)', 'substructure': 'N/A'} |
|---|