C15H11N3OS — CID 151961928
5-([1,2,4]thiadiazolo[4,5-a]benzimidazol-1-ylmethyl)cyclohexa-2,4-dien-1-one (PubChem CID 151961928) has the molecular formula C15H11N3OS and a molecular weight of 281.34 g/mol. Its IUPAC name is 5-([1,2,4]thiadiazolo[4,5-a]benzimidazol-1-ylmethyl)cyclohexa-2,4-dien-1-one.
| Compound Name | 5-([1,2,4]thiadiazolo[4,5-a]benzimidazol-1-ylmethyl)cyclohexa-2,4-dien-1-one |
|---|---|
| PubChem CID | 151961928 |
| Molecular Formula | C15H11N3OS |
| Molecular Weight | 281.34 g/mol |
| Exact Mass | 281.06 |
| IUPAC Name | 5-([1,2,4]thiadiazolo[4,5-a]benzimidazol-1-ylmethyl)cyclohexa-2,4-dien-1-one |
| SMILES | O=C1C=CC=C(Cc2nsc3nc4ccccc4n23)C1 |
| InChI | InChI=1S/C15H11N3OS/c19-11-5-3-4-10(8-11)9-14-17-20-15-16-12-6-1-2-7-13(12)18(14)15/h1-7H,8-9H2 |
| InChIKey | TYVOXFQXUDXZTK-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 47.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.34 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het_thio_N_5A(3)', 'substructure': 'N/A'} |
|---|