C13H13N3OS — CID 23303100
1-cyclopentyloxy-[1,2,4]thiadiazolo[4,5-a]benzimidazole (PubChem CID 23303100) has the molecular formula C13H13N3OS and a molecular weight of 259.33 g/mol. Its IUPAC name is 1-cyclopentyloxy-[1,2,4]thiadiazolo[4,5-a]benzimidazole.
| Compound Name | 1-cyclopentyloxy-[1,2,4]thiadiazolo[4,5-a]benzimidazole |
|---|---|
| PubChem CID | 23303100 |
| Molecular Formula | C13H13N3OS |
| Molecular Weight | 259.33 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | 1-cyclopentyloxy-[1,2,4]thiadiazolo[4,5-a]benzimidazole |
| SMILES | c1ccc2c(c1)nc1snc(OC3CCCC3)n12 |
| InChI | InChI=1S/C13H13N3OS/c1-2-6-9(5-1)17-12-15-18-13-14-10-7-3-4-8-11(10)16(12)13/h3-4,7-9H,1-2,5-6H2 |
| InChIKey | XOURTYXBSAPMCT-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 39.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.33 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het_thio_N_5A(3)', 'substructure': 'N/A'} |
|---|