C17H18NO4- — CID 23308528
(1S,2S,3R,4S)-3-[(4-acetylphenyl)carbamoyl]bicyclo[2.2.1]heptane-2-carboxylate (PubChem CID 23308528) has the molecular formula C17H18NO4- and a molecular weight of 300.33 g/mol. Its IUPAC name is (1S,2S,3R,4S)-3-[(4-acetylphenyl)carbamoyl]bicyclo[2.2.1]heptane-2-carboxylate.
| Compound Name | (1S,2S,3R,4S)-3-[(4-acetylphenyl)carbamoyl]bicyclo[2.2.1]heptane-2-carboxylate |
|---|---|
| PubChem CID | 23308528 |
| Molecular Formula | C17H18NO4- |
| Molecular Weight | 300.33 g/mol |
| Exact Mass | 300.12 |
| IUPAC Name | (1S,2S,3R,4S)-3-[(4-acetylphenyl)carbamoyl]bicyclo[2.2.1]heptane-2-carboxylate |
| SMILES | CC(=O)c1ccc(NC(=O)[C@@H]2[C@H]3CC[C@@H](C3)[C@@H]2C(=O)[O-])cc1 |
| InChI | InChI=1S/C17H19NO4/c1-9(19)10-4-6-13(7-5-10)18-16(20)14-11-2-3-12(8-11)15(14)17(21)22/h4-7,11-12,14-15H,2-3,8H2,1H3,(H,18,20)(H,21,22)/p-1/t11-,12-,14+,15-/m0/s1 |
| InChIKey | PMNXEXMMLCDUGS-VIRABCJISA-M |
| XLogP | 1.24 |
| TPSA | 86.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.33 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |