C22H28N4OS — CID 23309867
(2S)-N-(2,4-dimethylphenyl)-2-[[(1R,8R)-8,11,11-trimethyl-3,4,6-triazatricyclo[6.2.1.02,7]undeca-2(7),3,5-trien-5-yl]sulfanyl]propanamide (PubChem CID 23309867) has the molecular formula C22H28N4OS and a molecular weight of 396.56 g/mol. Its IUPAC name is (2S)-N-(2,4-dimethylphenyl)-2-[[(1R,8R)-8,11,11-trimethyl-3,4,6-triazatricyclo[6.2.1.02,7]undeca-2(7),3,5-trien-5-yl]sulfanyl]propanamide.
| Compound Name | (2S)-N-(2,4-dimethylphenyl)-2-[[(1R,8R)-8,11,11-trimethyl-3,4,6-triazatricyclo[6.2.1.02,7]undeca-2(7),3,5-trien-5-yl]sulfanyl]propanamide |
|---|---|
| PubChem CID | 23309867 |
| Molecular Formula | C22H28N4OS |
| Molecular Weight | 396.56 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | (2S)-N-(2,4-dimethylphenyl)-2-[[(1R,8R)-8,11,11-trimethyl-3,4,6-triazatricyclo[6.2.1.02,7]undeca-2(7),3,5-trien-5-yl]sulfanyl]propanamide |
| SMILES | Cc1ccc(NC(=O)[C@H](C)Sc2nnc3c(n2)[C@]2(C)CC[C@@H]3C2(C)C)c(C)c1 |
| InChI | InChI=1S/C22H28N4OS/c1-12-7-8-16(13(2)11-12)23-19(27)14(3)28-20-24-18-17(25-26-20)15-9-10-22(18,6)21(15,4)5/h7-8,11,14-15H,9-10H2,1-6H3,(H,23,27)/t14-,15-,22-/m0/s1 |
| InChIKey | HUGYMRCSEVANHW-DFFLPILJSA-N |
| XLogP | 4.78 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.56 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |