C22H24N4O2S — CID 22489849
5-[(2S)-2-[[(1R,8R)-8,11,11-trimethyl-3,4,6-triazatricyclo[6.2.1.02,7]undeca-2(7),3,5-trien-5-yl]sulfanyl]propanoyl]-1,3-dihydroindol-2-one (PubChem CID 22489849) has the molecular formula C22H24N4O2S and a molecular weight of 408.53 g/mol. Its IUPAC name is 5-[(2S)-2-[[(1R,8R)-8,11,11-trimethyl-3,4,6-triazatricyclo[6.2.1.02,7]undeca-2(7),3,5-trien-5-yl]sulfanyl]propanoyl]-1,3-dihydroindol-2-one.
| Compound Name | 5-[(2S)-2-[[(1R,8R)-8,11,11-trimethyl-3,4,6-triazatricyclo[6.2.1.02,7]undeca-2(7),3,5-trien-5-yl]sulfanyl]propanoyl]-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 22489849 |
| Molecular Formula | C22H24N4O2S |
| Molecular Weight | 408.53 g/mol |
| Exact Mass | 408.16 |
| IUPAC Name | 5-[(2S)-2-[[(1R,8R)-8,11,11-trimethyl-3,4,6-triazatricyclo[6.2.1.02,7]undeca-2(7),3,5-trien-5-yl]sulfanyl]propanoyl]-1,3-dihydroindol-2-one |
| SMILES | C[C@H](Sc1nnc2c(n1)[C@]1(C)CC[C@@H]2C1(C)C)C(=O)c1ccc2c(c1)CC(=O)N2 |
| InChI | InChI=1S/C22H24N4O2S/c1-11(18(28)12-5-6-15-13(9-12)10-16(27)23-15)29-20-24-19-17(25-26-20)14-7-8-22(19,4)21(14,2)3/h5-6,9,11,14H,7-8,10H2,1-4H3,(H,23,27)/t11-,14-,22-/m0/s1 |
| InChIKey | KAMLIDQNGIYOFW-PJJWTOGQSA-N |
| XLogP | 3.90 |
| TPSA | 84.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.53 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |