C21H22N4O2S — CID 6492895
5-[2-[(8,11,11-trimethyl-3,4,6-triazatricyclo[6.2.1.02,7]undeca-2(7),3,5-trien-5-yl)sulfanyl]acetyl]-1,3-dihydroindol-2-one (PubChem CID 6492895) has the molecular formula C21H22N4O2S and a molecular weight of 394.50 g/mol. Its IUPAC name is 5-[2-[(8,11,11-trimethyl-3,4,6-triazatricyclo[6.2.1.02,7]undeca-2(7),3,5-trien-5-yl)sulfanyl]acetyl]-1,3-dihydroindol-2-one.
| Compound Name | 5-[2-[(8,11,11-trimethyl-3,4,6-triazatricyclo[6.2.1.02,7]undeca-2(7),3,5-trien-5-yl)sulfanyl]acetyl]-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 6492895 |
| Molecular Formula | C21H22N4O2S |
| Molecular Weight | 394.50 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | 5-[2-[(8,11,11-trimethyl-3,4,6-triazatricyclo[6.2.1.02,7]undeca-2(7),3,5-trien-5-yl)sulfanyl]acetyl]-1,3-dihydroindol-2-one |
| SMILES | CC12CCC(c3nnc(SCC(=O)c4ccc5c(c4)CC(=O)N5)nc31)C2(C)C |
| InChI | InChI=1S/C21H22N4O2S/c1-20(2)13-6-7-21(20,3)18-17(13)24-25-19(23-18)28-10-15(26)11-4-5-14-12(8-11)9-16(27)22-14/h4-5,8,13H,6-7,9-10H2,1-3H3,(H,22,27) |
| InChIKey | FXRAXGSEVSJEBQ-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 84.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.50 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |