C22H26N4O2S — CID 7477271
N-[4-[2-[[(1R,8S)-8,11,11-trimethyl-3,4,6-triazatricyclo[6.2.1.02,7]undeca-2(7),3,5-trien-5-yl]sulfanyl]acetyl]phenyl]propanamide (PubChem CID 7477271) has the molecular formula C22H26N4O2S and a molecular weight of 410.54 g/mol. Its IUPAC name is N-[4-[2-[[(1R,8S)-8,11,11-trimethyl-3,4,6-triazatricyclo[6.2.1.02,7]undeca-2(7),3,5-trien-5-yl]sulfanyl]acetyl]phenyl]propanamide.
| Compound Name | N-[4-[2-[[(1R,8S)-8,11,11-trimethyl-3,4,6-triazatricyclo[6.2.1.02,7]undeca-2(7),3,5-trien-5-yl]sulfanyl]acetyl]phenyl]propanamide |
|---|---|
| PubChem CID | 7477271 |
| Molecular Formula | C22H26N4O2S |
| Molecular Weight | 410.54 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | N-[4-[2-[[(1R,8S)-8,11,11-trimethyl-3,4,6-triazatricyclo[6.2.1.02,7]undeca-2(7),3,5-trien-5-yl]sulfanyl]acetyl]phenyl]propanamide |
| SMILES | CCC(=O)Nc1ccc(C(=O)CSc2nnc3c(n2)[C@@]2(C)CC[C@@H]3C2(C)C)cc1 |
| InChI | InChI=1S/C22H26N4O2S/c1-5-17(28)23-14-8-6-13(7-9-14)16(27)12-29-20-24-19-18(25-26-20)15-10-11-22(19,4)21(15,2)3/h6-9,15H,5,10-12H2,1-4H3,(H,23,28)/t15-,22+/m0/s1 |
| InChIKey | SMWWPLLULOVTKJ-OYHNWAKOSA-N |
| XLogP | 4.37 |
| TPSA | 84.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.54 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |