C22H24N4OS — CID 22489834
1-(2-methyl-1H-indol-3-yl)-2-[[(1S,8S)-8,11,11-trimethyl-3,4,6-triazatricyclo[6.2.1.02,7]undeca-2(7),3,5-trien-5-yl]sulfanyl]ethanone (PubChem CID 22489834) has the molecular formula C22H24N4OS and a molecular weight of 392.53 g/mol. Its IUPAC name is 1-(2-methyl-1H-indol-3-yl)-2-[[(1S,8S)-8,11,11-trimethyl-3,4,6-triazatricyclo[6.2.1.02,7]undeca-2(7),3,5-trien-5-yl]sulfanyl]ethanone.
| Compound Name | 1-(2-methyl-1H-indol-3-yl)-2-[[(1S,8S)-8,11,11-trimethyl-3,4,6-triazatricyclo[6.2.1.02,7]undeca-2(7),3,5-trien-5-yl]sulfanyl]ethanone |
|---|---|
| PubChem CID | 22489834 |
| Molecular Formula | C22H24N4OS |
| Molecular Weight | 392.53 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | 1-(2-methyl-1H-indol-3-yl)-2-[[(1S,8S)-8,11,11-trimethyl-3,4,6-triazatricyclo[6.2.1.02,7]undeca-2(7),3,5-trien-5-yl]sulfanyl]ethanone |
| SMILES | Cc1[nH]c2ccccc2c1C(=O)CSc1nnc2c(n1)[C@@]1(C)CC[C@H]2C1(C)C |
| InChI | InChI=1S/C22H24N4OS/c1-12-17(13-7-5-6-8-15(13)23-12)16(27)11-28-20-24-19-18(25-26-20)14-9-10-22(19,4)21(14,2)3/h5-8,14,23H,9-11H2,1-4H3/t14-,22-/m1/s1 |
| InChIKey | SBFDSAWXXZJANB-JLCFBVMHSA-N |
| XLogP | 4.81 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.53 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |