C20H22ClN3O2S — CID 6486737
1-(5-chloro-2-methoxyphenyl)-2-[(8,11,11-trimethyl-3,4,6-triazatricyclo[6.2.1.02,7]undeca-2(7),3,5-trien-5-yl)sulfanyl]ethanone (PubChem CID 6486737) has the molecular formula C20H22ClN3O2S and a molecular weight of 403.94 g/mol. Its IUPAC name is 1-(5-chloro-2-methoxyphenyl)-2-[(8,11,11-trimethyl-3,4,6-triazatricyclo[6.2.1.02,7]undeca-2(7),3,5-trien-5-yl)sulfanyl]ethanone.
| Compound Name | 1-(5-chloro-2-methoxyphenyl)-2-[(8,11,11-trimethyl-3,4,6-triazatricyclo[6.2.1.02,7]undeca-2(7),3,5-trien-5-yl)sulfanyl]ethanone |
|---|---|
| PubChem CID | 6486737 |
| Molecular Formula | C20H22ClN3O2S |
| Molecular Weight | 403.94 g/mol |
| Exact Mass | 403.11 |
| IUPAC Name | 1-(5-chloro-2-methoxyphenyl)-2-[(8,11,11-trimethyl-3,4,6-triazatricyclo[6.2.1.02,7]undeca-2(7),3,5-trien-5-yl)sulfanyl]ethanone |
| SMILES | COc1ccc(Cl)cc1C(=O)CSc1nnc2c(n1)C1(C)CCC2C1(C)C |
| InChI | InChI=1S/C20H22ClN3O2S/c1-19(2)13-7-8-20(19,3)17-16(13)23-24-18(22-17)27-10-14(25)12-9-11(21)5-6-15(12)26-4/h5-6,9,13H,7-8,10H2,1-4H3 |
| InChIKey | YOBUQUGJWCTUQX-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 64.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.94 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |