C15H15NO5S — CID 23312094
N-[3-(4,5-dihydroxy-2-methylphenyl)sulfonylphenyl]acetamide (PubChem CID 23312094) has the molecular formula C15H15NO5S and a molecular weight of 321.35 g/mol. Its IUPAC name is N-[3-(4,5-dihydroxy-2-methylphenyl)sulfonylphenyl]acetamide.
| Compound Name | N-[3-(4,5-dihydroxy-2-methylphenyl)sulfonylphenyl]acetamide |
|---|---|
| PubChem CID | 23312094 |
| Molecular Formula | C15H15NO5S |
| Molecular Weight | 321.35 g/mol |
| Exact Mass | 321.07 |
| IUPAC Name | N-[3-(4,5-dihydroxy-2-methylphenyl)sulfonylphenyl]acetamide |
| SMILES | CC(=O)Nc1cccc(S(=O)(=O)c2cc(O)c(O)cc2C)c1 |
| InChI | InChI=1S/C15H15NO5S/c1-9-6-13(18)14(19)8-15(9)22(20,21)12-5-3-4-11(7-12)16-10(2)17/h3-8,18-19H,1-2H3,(H,16,17) |
| InChIKey | SGENNIYWVTWILU-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.35 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|