C17H20N2O3 — CID 2331270
(2Z)-2-[(3-ethoxy-4-hydroxyphenyl)methylidene]-6,7,8,9-tetrahydro-5H-imidazo[1,2-a]azepin-3-one (PubChem CID 2331270) has the molecular formula C17H20N2O3 and a molecular weight of 300.36 g/mol. Its IUPAC name is (2Z)-2-[(3-ethoxy-4-hydroxyphenyl)methylidene]-6,7,8,9-tetrahydro-5H-imidazo[1,2-a]azepin-3-one.
| Compound Name | (2Z)-2-[(3-ethoxy-4-hydroxyphenyl)methylidene]-6,7,8,9-tetrahydro-5H-imidazo[1,2-a]azepin-3-one |
|---|---|
| PubChem CID | 2331270 |
| Molecular Formula | C17H20N2O3 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.15 |
| IUPAC Name | (2Z)-2-[(3-ethoxy-4-hydroxyphenyl)methylidene]-6,7,8,9-tetrahydro-5H-imidazo[1,2-a]azepin-3-one |
| SMILES | CCOc1cc(/C=C2\N=C3CCCCCN3C2=O)ccc1O |
| InChI | InChI=1S/C17H20N2O3/c1-2-22-15-11-12(7-8-14(15)20)10-13-17(21)19-9-5-3-4-6-16(19)18-13/h7-8,10-11,20H,2-6,9H2,1H3/b13-10- |
| InChIKey | CQDFIJDPEVAZDP-RAXLEYEMSA-N |
| XLogP | 2.95 |
| TPSA | 62.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|