C17H21BrN2O — CID 23315542
4-bromo-N-[2-(2,5-dihydropyrrol-1-yl)cyclohexyl]benzamide (PubChem CID 23315542) has the molecular formula C17H21BrN2O and a molecular weight of 349.27 g/mol. Its IUPAC name is 4-bromo-N-[2-(2,5-dihydropyrrol-1-yl)cyclohexyl]benzamide.
| Compound Name | 4-bromo-N-[2-(2,5-dihydropyrrol-1-yl)cyclohexyl]benzamide |
|---|---|
| PubChem CID | 23315542 |
| Molecular Formula | C17H21BrN2O |
| Molecular Weight | 349.27 g/mol |
| Exact Mass | 348.08 |
| IUPAC Name | 4-bromo-N-[2-(2,5-dihydropyrrol-1-yl)cyclohexyl]benzamide |
| SMILES | O=C(NC1CCCCC1N1CC=CC1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C17H21BrN2O/c18-14-9-7-13(8-10-14)17(21)19-15-5-1-2-6-16(15)20-11-3-4-12-20/h3-4,7-10,15-16H,1-2,5-6,11-12H2,(H,19,21) |
| InChIKey | RQXZOXFXBOLDLY-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.27 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|