C28H43N3O8 — CID 23316401
2-methylpropyl 2-[[4-methyl-1-oxo-1-[4-[(2,3,4-trimethoxyphenyl)methyl]piperazin-1-yl]pentan-2-yl]carbamoyl]oxirane-2-carboxylate (PubChem CID 23316401) has the molecular formula C28H43N3O8 and a molecular weight of 549.67 g/mol. Its IUPAC name is 2-methylpropyl 2-[[4-methyl-1-oxo-1-[4-[(2,3,4-trimethoxyphenyl)methyl]piperazin-1-yl]pentan-2-yl]carbamoyl]oxirane-2-carboxylate.
| Compound Name | 2-methylpropyl 2-[[4-methyl-1-oxo-1-[4-[(2,3,4-trimethoxyphenyl)methyl]piperazin-1-yl]pentan-2-yl]carbamoyl]oxirane-2-carboxylate |
|---|---|
| PubChem CID | 23316401 |
| Molecular Formula | C28H43N3O8 |
| Molecular Weight | 549.67 g/mol |
| Exact Mass | 549.31 |
| IUPAC Name | 2-methylpropyl 2-[[4-methyl-1-oxo-1-[4-[(2,3,4-trimethoxyphenyl)methyl]piperazin-1-yl]pentan-2-yl]carbamoyl]oxirane-2-carboxylate |
| SMILES | COc1ccc(CN2CCN(C(=O)C(CC(C)C)NC(=O)C3(C(=O)OCC(C)C)CO3)CC2)c(OC)c1OC |
| InChI | InChI=1S/C28H43N3O8/c1-18(2)14-21(29-26(33)28(17-39-28)27(34)38-16-19(3)4)25(32)31-12-10-30(11-13-31)15-20-8-9-22(35-5)24(37-7)23(20)36-6/h8-9,18-19,21H,10-17H2,1-7H3,(H,29,33) |
| InChIKey | YMZLKYYSEFGFPQ-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 119.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.67 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|