C15H16N6 — CID 23323070
5-[(5-amino-4-methylquinolin-6-yl)methyl]pyrimidine-2,4-diamine (PubChem CID 23323070) has the molecular formula C15H16N6 and a molecular weight of 280.34 g/mol. Its IUPAC name is 5-[(5-amino-4-methylquinolin-6-yl)methyl]pyrimidine-2,4-diamine.
| Compound Name | 5-[(5-amino-4-methylquinolin-6-yl)methyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 23323070 |
| Molecular Formula | C15H16N6 |
| Molecular Weight | 280.34 g/mol |
| Exact Mass | 280.14 |
| IUPAC Name | 5-[(5-amino-4-methylquinolin-6-yl)methyl]pyrimidine-2,4-diamine |
| SMILES | Cc1ccnc2ccc(Cc3cnc(N)nc3N)c(N)c12 |
| InChI | InChI=1S/C15H16N6/c1-8-4-5-19-11-3-2-9(13(16)12(8)11)6-10-7-20-15(18)21-14(10)17/h2-5,7H,6,16H2,1H3,(H4,17,18,20,21) |
| InChIKey | AEVPVLVQOALREA-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 116.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.34 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|