C18H21ClN2O3 — CID 23328047
7-chloro-N-[(E)-[(1R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino]-1,3-benzodioxole-5-carboxamide (PubChem CID 23328047) has the molecular formula C18H21ClN2O3 and a molecular weight of 348.83 g/mol. Its IUPAC name is 7-chloro-N-[(E)-[(1R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino]-1,3-benzodioxole-5-carboxamide.
| Compound Name | 7-chloro-N-[(E)-[(1R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino]-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 23328047 |
| Molecular Formula | C18H21ClN2O3 |
| Molecular Weight | 348.83 g/mol |
| Exact Mass | 348.12 |
| IUPAC Name | 7-chloro-N-[(E)-[(1R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino]-1,3-benzodioxole-5-carboxamide |
| SMILES | CC1(C)[C@H]2CC[C@@]1(C)/C(=N/NC(=O)c1cc(Cl)c3c(c1)OCO3)C2 |
| InChI | InChI=1S/C18H21ClN2O3/c1-17(2)11-4-5-18(17,3)14(8-11)20-21-16(22)10-6-12(19)15-13(7-10)23-9-24-15/h6-7,11H,4-5,8-9H2,1-3H3,(H,21,22)/b20-14+/t11-,18-/m0/s1 |
| InChIKey | GHBMJNPKRUOPDS-HZQMPHPSSA-N |
| XLogP | 4.00 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.83 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|