C22H34N2O3 — CID 23328259
2-[2-[[(1S,2R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]oxy]ethylamino]ethyl N-(2-methylphenyl)carbamate (PubChem CID 23328259) has the molecular formula C22H34N2O3 and a molecular weight of 374.53 g/mol. Its IUPAC name is 2-[2-[[(1S,2R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]oxy]ethylamino]ethyl N-(2-methylphenyl)carbamate.
| Compound Name | 2-[2-[[(1S,2R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]oxy]ethylamino]ethyl N-(2-methylphenyl)carbamate |
|---|---|
| PubChem CID | 23328259 |
| Molecular Formula | C22H34N2O3 |
| Molecular Weight | 374.53 g/mol |
| Exact Mass | 374.26 |
| IUPAC Name | 2-[2-[[(1S,2R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]oxy]ethylamino]ethyl N-(2-methylphenyl)carbamate |
| SMILES | Cc1ccccc1NC(=O)OCCNCCO[C@@H]1C[C@H]2CC[C@@]1(C)C2(C)C |
| InChI | InChI=1S/C22H34N2O3/c1-16-7-5-6-8-18(16)24-20(25)27-14-12-23-11-13-26-19-15-17-9-10-22(19,4)21(17,2)3/h5-8,17,19,23H,9-15H2,1-4H3,(H,24,25)/t17-,19-,22-/m1/s1 |
| InChIKey | SIOIWEQKZLISIA-SFGWALBWSA-N |
| XLogP | 4.36 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.53 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|