C23H28O4 — CID 23329023
5-(hydroxymethyl)-2,2-dimethyl-7-(5-phenylpentoxy)-3H-chromen-4-one (PubChem CID 23329023) has the molecular formula C23H28O4 and a molecular weight of 368.47 g/mol. Its IUPAC name is 5-(hydroxymethyl)-2,2-dimethyl-7-(5-phenylpentoxy)-3H-chromen-4-one.
| Compound Name | 5-(hydroxymethyl)-2,2-dimethyl-7-(5-phenylpentoxy)-3H-chromen-4-one |
|---|---|
| PubChem CID | 23329023 |
| Molecular Formula | C23H28O4 |
| Molecular Weight | 368.47 g/mol |
| Exact Mass | 368.20 |
| IUPAC Name | 5-(hydroxymethyl)-2,2-dimethyl-7-(5-phenylpentoxy)-3H-chromen-4-one |
| SMILES | CC1(C)CC(=O)c2c(CO)cc(OCCCCCc3ccccc3)cc2O1 |
| InChI | InChI=1S/C23H28O4/c1-23(2)15-20(25)22-18(16-24)13-19(14-21(22)27-23)26-12-8-4-7-11-17-9-5-3-6-10-17/h3,5-6,9-10,13-14,24H,4,7-8,11-12,15-16H2,1-2H3 |
| InChIKey | MPJMCGBIDQJSAN-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.47 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|