C23H28N3O4S+ — CID 2332939
4-(4-methylphenyl)sulfonyl-N-(3-morpholin-4-ium-4-ylpropyl)-2-phenyl-1,3-oxazol-5-amine (PubChem CID 2332939) has the molecular formula C23H28N3O4S+ and a molecular weight of 442.56 g/mol. Its IUPAC name is 4-(4-methylphenyl)sulfonyl-N-(3-morpholin-4-ium-4-ylpropyl)-2-phenyl-1,3-oxazol-5-amine.
| Compound Name | 4-(4-methylphenyl)sulfonyl-N-(3-morpholin-4-ium-4-ylpropyl)-2-phenyl-1,3-oxazol-5-amine |
|---|---|
| PubChem CID | 2332939 |
| Molecular Formula | C23H28N3O4S+ |
| Molecular Weight | 442.56 g/mol |
| Exact Mass | 442.18 |
| IUPAC Name | 4-(4-methylphenyl)sulfonyl-N-(3-morpholin-4-ium-4-ylpropyl)-2-phenyl-1,3-oxazol-5-amine |
| SMILES | Cc1ccc(S(=O)(=O)c2nc(-c3ccccc3)oc2NCCC[NH+]2CCOCC2)cc1 |
| InChI | InChI=1S/C23H27N3O4S/c1-18-8-10-20(11-9-18)31(27,28)23-22(24-12-5-13-26-14-16-29-17-15-26)30-21(25-23)19-6-3-2-4-7-19/h2-4,6-11,24H,5,12-17H2,1H3/p+1 |
| InChIKey | RUWCOKUHCHYZJQ-UHFFFAOYSA-O |
| XLogP | 2.20 |
| TPSA | 85.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.56 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|