C16H10BrF4N3O — CID 23332714
7-bromo-3-fluoro-5-pyridin-2-yl-1-(2,2,2-trifluoroethyl)-3H-1,4-benzodiazepin-2-one (PubChem CID 23332714) has the molecular formula C16H10BrF4N3O and a molecular weight of 416.17 g/mol. Its IUPAC name is 7-bromo-3-fluoro-5-pyridin-2-yl-1-(2,2,2-trifluoroethyl)-3H-1,4-benzodiazepin-2-one.
| Compound Name | 7-bromo-3-fluoro-5-pyridin-2-yl-1-(2,2,2-trifluoroethyl)-3H-1,4-benzodiazepin-2-one |
|---|---|
| PubChem CID | 23332714 |
| Molecular Formula | C16H10BrF4N3O |
| Molecular Weight | 416.17 g/mol |
| Exact Mass | 414.99 |
| IUPAC Name | 7-bromo-3-fluoro-5-pyridin-2-yl-1-(2,2,2-trifluoroethyl)-3H-1,4-benzodiazepin-2-one |
| SMILES | O=C1C(F)N=C(c2ccccn2)c2cc(Br)ccc2N1CC(F)(F)F |
| InChI | InChI=1S/C16H10BrF4N3O/c17-9-4-5-12-10(7-9)13(11-3-1-2-6-22-11)23-14(18)15(25)24(12)8-16(19,20)21/h1-7,14H,8H2 |
| InChIKey | QHECSXLLJSMNAB-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 45.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.17 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|