C18H21NO4 — CID 23335297
3-(3H-1,2-benzodioxol-6-yloxy)-2-methoxy-N-methyl-3-phenylpropan-1-amine (PubChem CID 23335297) has the molecular formula C18H21NO4 and a molecular weight of 315.37 g/mol. Its IUPAC name is 3-(3H-1,2-benzodioxol-6-yloxy)-2-methoxy-N-methyl-3-phenylpropan-1-amine.
| Compound Name | 3-(3H-1,2-benzodioxol-6-yloxy)-2-methoxy-N-methyl-3-phenylpropan-1-amine |
|---|---|
| PubChem CID | 23335297 |
| Molecular Formula | C18H21NO4 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.15 |
| IUPAC Name | 3-(3H-1,2-benzodioxol-6-yloxy)-2-methoxy-N-methyl-3-phenylpropan-1-amine |
| SMILES | CNCC(OC)C(Oc1ccc2c(c1)OOC2)c1ccccc1 |
| InChI | InChI=1S/C18H21NO4/c1-19-11-17(20-2)18(13-6-4-3-5-7-13)22-15-9-8-14-12-21-23-16(14)10-15/h3-10,17-19H,11-12H2,1-2H3 |
| InChIKey | UOWRHKFGBPZHPR-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 48.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|