C18H22O3 — CID 23336343
(5-prop-2-ynylfuran-3-yl)methyl 2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxylate (PubChem CID 23336343) has the molecular formula C18H22O3 and a molecular weight of 286.37 g/mol. Its IUPAC name is (5-prop-2-ynylfuran-3-yl)methyl 2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxylate.
| Compound Name | (5-prop-2-ynylfuran-3-yl)methyl 2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 23336343 |
| Molecular Formula | C18H22O3 |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.16 |
| IUPAC Name | (5-prop-2-ynylfuran-3-yl)methyl 2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxylate |
| SMILES | C#CCc1cc(COC(=O)C2C(C=C(C)C)C2(C)C)co1 |
| InChI | InChI=1S/C18H22O3/c1-6-7-14-9-13(10-20-14)11-21-17(19)16-15(8-12(2)3)18(16,4)5/h1,8-10,15-16H,7,11H2,2-5H3 |
| InChIKey | FDGUPZHFECYGTN-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|