C17H21N3OS — CID 23340463
3,5-dimethyl-N-(2,4,6-trimethylphenyl)-5,6-dihydroimidazo[2,1-b][1,3]thiazole-2-carboxamide (PubChem CID 23340463) has the molecular formula C17H21N3OS and a molecular weight of 315.44 g/mol. Its IUPAC name is 3,5-dimethyl-N-(2,4,6-trimethylphenyl)-5,6-dihydroimidazo[2,1-b][1,3]thiazole-2-carboxamide.
| Compound Name | 3,5-dimethyl-N-(2,4,6-trimethylphenyl)-5,6-dihydroimidazo[2,1-b][1,3]thiazole-2-carboxamide |
|---|---|
| PubChem CID | 23340463 |
| Molecular Formula | C17H21N3OS |
| Molecular Weight | 315.44 g/mol |
| Exact Mass | 315.14 |
| IUPAC Name | 3,5-dimethyl-N-(2,4,6-trimethylphenyl)-5,6-dihydroimidazo[2,1-b][1,3]thiazole-2-carboxamide |
| SMILES | CC1=C(C(=O)Nc2c(C)cc(C)cc2C)SC2=NCC(C)N21 |
| InChI | InChI=1S/C17H21N3OS/c1-9-6-10(2)14(11(3)7-9)19-16(21)15-13(5)20-12(4)8-18-17(20)22-15/h6-7,12H,8H2,1-5H3,(H,19,21) |
| InChIKey | WMXISCOSCZSRTO-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.44 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |