About butyl prop-1-ynyl phosphite
butyl prop-1-ynyl phosphite (PubChem CID 23341763) has the molecular formula C7H12O3P-
and a molecular weight of 175.14 g/mol. Its IUPAC name is butyl prop-1-ynyl phosphite.
Molecular Properties
| Compound Name | butyl prop-1-ynyl phosphite |
| PubChem CID | 23341763 |
| Molecular Formula | C7H12O3P- |
| Molecular Weight | 175.14 g/mol |
| Exact Mass | 175.05 |
| IUPAC Name | butyl prop-1-ynyl phosphite |
| SMILES | CC#COP([O-])OCCCC |
| InChI | InChI=1S/C7H12O3P/c1-3-5-7-10-11(8)9-6-4-2/h3,5,7H2,1-2H3/q-1 |
| InChIKey | WTPQLIOEMCSUHW-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 41.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.14 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze butyl prop-1-ynyl phosphite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl prop-1-ynyl phosphite?
The IUPAC name of butyl prop-1-ynyl phosphite (CID 23341763) is butyl prop-1-ynyl phosphite.
What is the SMILES notation for butyl prop-1-ynyl phosphite?
The canonical SMILES for butyl prop-1-ynyl phosphite is CC#COP([O-])OCCCC.
What is the InChIKey of butyl prop-1-ynyl phosphite?
The InChIKey is WTPQLIOEMCSUHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12O3P/c1-3-5-7-10-11(8)9-6-4-2/h3,5,7H2,1-2H3/q-1.
What are the key properties of butyl prop-1-ynyl phosphite?
butyl prop-1-ynyl phosphite has a molecular weight of 175.14 g/mol, XLogP of 1.39, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for butyl prop-1-ynyl phosphite is sourced from PubChem (CID 23341763), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).