C13H14N2O6S — CID 23342595
2-[2-(2-methyl-4-sulfophenyl)-3-oxo-1H-pyrazol-5-yl]propanoic acid (PubChem CID 23342595) has the molecular formula C13H14N2O6S and a molecular weight of 326.33 g/mol. Its IUPAC name is 2-[2-(2-methyl-4-sulfophenyl)-3-oxo-1H-pyrazol-5-yl]propanoic acid.
| Compound Name | 2-[2-(2-methyl-4-sulfophenyl)-3-oxo-1H-pyrazol-5-yl]propanoic acid |
|---|---|
| PubChem CID | 23342595 |
| Molecular Formula | C13H14N2O6S |
| Molecular Weight | 326.33 g/mol |
| Exact Mass | 326.06 |
| IUPAC Name | 2-[2-(2-methyl-4-sulfophenyl)-3-oxo-1H-pyrazol-5-yl]propanoic acid |
| SMILES | Cc1cc(S(=O)(=O)O)ccc1-n1[nH]c(C(C)C(=O)O)cc1=O |
| InChI | InChI=1S/C13H14N2O6S/c1-7-5-9(22(19,20)21)3-4-11(7)15-12(16)6-10(14-15)8(2)13(17)18/h3-6,8,14H,1-2H3,(H,17,18)(H,19,20,21) |
| InChIKey | JBLGYQGBENJGGJ-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 129.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.33 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|