C25H28N2O3S — CID 2334371
N-benzyl-N-methyl-2-[(2,3,5,6-tetramethylphenyl)sulfonylamino]benzamide (PubChem CID 2334371) has the molecular formula C25H28N2O3S and a molecular weight of 436.58 g/mol. Its IUPAC name is N-benzyl-N-methyl-2-[(2,3,5,6-tetramethylphenyl)sulfonylamino]benzamide.
| Compound Name | N-benzyl-N-methyl-2-[(2,3,5,6-tetramethylphenyl)sulfonylamino]benzamide |
|---|---|
| PubChem CID | 2334371 |
| Molecular Formula | C25H28N2O3S |
| Molecular Weight | 436.58 g/mol |
| Exact Mass | 436.18 |
| IUPAC Name | N-benzyl-N-methyl-2-[(2,3,5,6-tetramethylphenyl)sulfonylamino]benzamide |
| SMILES | Cc1cc(C)c(C)c(S(=O)(=O)Nc2ccccc2C(=O)N(C)Cc2ccccc2)c1C |
| InChI | InChI=1S/C25H28N2O3S/c1-17-15-18(2)20(4)24(19(17)3)31(29,30)26-23-14-10-9-13-22(23)25(28)27(5)16-21-11-7-6-8-12-21/h6-15,26H,16H2,1-5H3 |
| InChIKey | VFWKTSIROKXSRY-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.58 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |